Showing entry for Gravacridonediol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000153 |
| Compound Name | Gravacridonediol |
| Structure | ![]() |
| Formula | C19H19NO5 |
| InchiKey | RQAGSTDFTGSIGB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2)C(=O)C2=C1C1=C(OC(C1)C(C)(O)CO)C=C2O |
| Inchi | InChI=1S/C19H19NO5/c1-19(24,9-21)15-7-11-14(25-15)8-13(22)16-17(11)20(2)12-6-4-3-5-10(12)18(16)23/h3-6,8,15,21-22,24H,7,9H2,1-2H3 |
| IUPAC | 2-(1,2-dihydroxypropan-2-yl)-5-hydroxy-11-methyl-1H,2H,6H,11H-furo[2,3-c]acridin-6-one |
| Molecular Weight | 341.36 |
| Pubchem Id | 5317836 |
| Chembl Id | CHEMBL562500 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL562500 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
