Showing entry for 1-(3,4-Dimethoxyphenyl)ethanone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000220 |
| Compound Name | 1-(3,4-Dimethoxyphenyl)ethanone |
| Structure | ![]() |
| Formula | C10H12O3 |
| InchiKey | IQZLUWLMQNGTIW-UHFFFAOYSA-N |
| SMILES | COC1=C(OC)C=C(C=C1)C(C)=O |
| Inchi | InChI=1S/C10H12O3/c1-7(11)8-4-5-9(12-2)10(6-8)13-3/h4-6H,1-3H3 |
| IUPAC | 1-(3,4-dimethoxyphenyl)ethan-1-one |
| Molecular Weight | 180.2 |
| Pubchem Id | 14328 |
| Chembl Id | CHEMBL4218890 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4218890 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
