Showing entry for Eugenitol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000300 |
| Compound Name | Eugenitol |
| Structure | ![]() |
| Formula | C11H10O4 |
| InchiKey | HMAUJNAGOIPKDG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C=C(O)C(C)=C2O |
| Inchi | InChI=1S/C11H10O4/c1-5-3-8(13)10-9(15-5)4-7(12)6(2)11(10)14/h3-4,12,14H,1-2H3 |
| IUPAC | 5,7-dihydroxy-2,6-dimethyl-4H-chromen-4-one |
| Molecular Weight | 206.19 |
| Pubchem Id | 5036604 |
| Chembl Id | CHEMBL3039487 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3039487 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
