Showing entry for Licoricone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000357 |
| Compound Name | Licoricone |
| Structure | ![]() |
| Formula | C22H22O6 |
| InchiKey | GGWMNTNDTRKETA-UHFFFAOYSA-N |
| SMILES | COC1=C(CC=C(C)C)C(OC)=C(C(O)=C1)C1=COC2=C(C=CC(O)=C2)C1=O |
| Inchi | InChI=1S/C22H22O6/c1-12(2)5-7-15-18(26-3)10-17(24)20(22(15)27-4)16-11-28-19-9-13(23)6-8-14(19)21(16)25/h5-6,8-11,23-24H,7H2,1-4H3 |
| IUPAC | 7-hydroxy-3-[6-hydroxy-2,4-dimethoxy-3-(3-methylbut-2-en-1-yl)phenyl]-4H-chromen-4-one |
| Molecular Weight | 382.41 |
| Pubchem Id | 5319013 |
| Chembl Id | CHEMBL4067137 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4067137 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
