Showing entry for Liquiritigenin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000361 |
| Compound Name | Liquiritigenin |
| Structure | ![]() |
| Formula | C15H12O4 |
| InchiKey | FURUXTVZLHCCNA-UHFFFAOYSA-N |
| SMILES | OC1=CC=C(C=C1)C1CC(=O)C2=C(O1)C=C(O)C=C2 |
| Inchi | InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2 |
| IUPAC | 7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one |
| Molecular Weight | 256.26 |
| Pubchem Id | 1889 |
| Chembl Id | CHEMBL271939 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50228333 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL271939 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
