Showing entry for 3-Methylgalangin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000364 |
| Compound Name | 3-Methylgalangin |
| Structure | ![]() |
| Formula | C16H12O5 |
| InchiKey | LYISDADPVOHJBJ-UHFFFAOYSA-N |
| SMILES | COC1=C(OC2=CC(O)=CC(O)=C2C1=O)C1=CC=CC=C1 |
| Inchi | InChI=1S/C16H12O5/c1-20-16-14(19)13-11(18)7-10(17)8-12(13)21-15(16)9-5-3-2-4-6-9/h2-8,17-18H,1H3 |
| IUPAC | 5,7-dihydroxy-3-methoxy-2-phenyl-4H-chromen-4-one |
| Molecular Weight | 284.26 |
| Pubchem Id | 5281946 |
| Chembl Id | CHEMBL1822221 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50423814 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1822221 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
