Showing entry for 2-Hydroxy-4-methoxybenzoic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000501 |
| Compound Name | 2-Hydroxy-4-methoxybenzoic acid |
| Structure | ![]() |
| Formula | C8H8O4 |
| InchiKey | MRIXVKKOHPQOFK-UHFFFAOYSA-N |
| SMILES | COC1=CC(O)=C(C=C1)C(O)=O |
| Inchi | InChI=1S/C8H8O4/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3,(H,10,11) |
| IUPAC | 2-hydroxy-4-methoxybenzoic acid |
| Molecular Weight | 168.15 |
| Pubchem Id | 75231 |
| Chembl Id | CHEMBL507095 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL507095 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
