Showing entry for Galacturonic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000729 |
| Compound Name | Galacturonic acid |
| Structure | ![]() |
| Formula | C6H10O7 |
| InchiKey | IAJILQKETJEXLJ-RSJOWCBRSA-N |
| SMILES | O[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O |
| Inchi | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1 |
| IUPAC | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| Molecular Weight | 194.14 |
| Pubchem Id | 84740 |
| Chembl Id |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | DGU |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
