Showing entry for 1-Isomangostin hydrate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0000800 |
| Compound Name | 1-Isomangostin hydrate |
| Structure | ![]() |
| Formula | C24H28O7 |
| InchiKey | QEERGWNVXZILOR-UHFFFAOYSA-N |
| SMILES | COC1=C(CCC(C)(C)O)C2=C(OC3=C(C2=O)C2=C(CCC(C)(C)O2)C(O)=C3)C=C1O |
| Inchi | InChI=1S/C24H28O7/c1-23(2,28)8-6-13-18-16(11-15(26)21(13)29-5)30-17-10-14(25)12-7-9-24(3,4)31-22(12)19(17)20(18)27/h10-11,25-26,28H,6-9H2,1-5H3 |
| IUPAC | 5,9-dihydroxy-11-(3-hydroxy-3-methylbutyl)-10-methoxy-2,2-dimethyl-2,3,4,12-tetrahydro-1,7-dioxatetraphen-12-one |
| Molecular Weight | 428.47 |
| Pubchem Id | 13873659 |
| Chembl Id | CHEMBL1789657 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50346342 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1789657 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
