Showing entry for Cerasidin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001075 |
| Compound Name | Cerasidin |
| Structure | ![]() |
| Formula | C19H20O6 |
| InchiKey | IAUDUEQNUVKNBT-SOFGYWHQSA-N |
| SMILES | COC1=CC=C(\C=C\C(=O)C2=C(OC)C=C(OC)C=C2O)C(OC)=C1 |
| Inchi | InChI=1S/C19H20O6/c1-22-13-7-5-12(17(10-13)24-3)6-8-15(20)19-16(21)9-14(23-2)11-18(19)25-4/h5-11,21H,1-4H3/b8-6+ |
| IUPAC | (2E)-3-(2,4-dimethoxyphenyl)-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-2-en-1-one |
| Molecular Weight | 344.36 |
| Pubchem Id | 14034812 |
| Chembl Id | CHEMBL3393847 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3393847 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
