Showing entry for Isosojagol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001392 |
| Compound Name | Isosojagol |
| Structure | ![]() |
| Formula | C20H16O5 |
| InchiKey | MQKLGUOASGICKG-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C(O)C=CC2=C1OC1=C2C(=O)OC2=C1C=CC(O)=C2 |
| Inchi | InChI=1S/C20H16O5/c1-10(2)3-5-12-15(22)8-7-14-17-19(25-18(12)14)13-6-4-11(21)9-16(13)24-20(17)23/h3-4,6-9,21-22H,5H2,1-2H3 |
| IUPAC | 5,14-dihydroxy-15-(3-methylbut-2-en-1-yl)-8,17-dioxatetracyclo[8.7.0.02,?.011,1?]heptadeca-1(10),2(7),3,5,11(16),12,14-heptaen-9-one |
| Molecular Weight | 336.34 |
| Pubchem Id | 16744613 |
| Chembl Id | CHEMBL1094311 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1094311 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
