Showing entry for Glisoflavanone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001399 |
| Compound Name | Glisoflavanone |
| Structure | ![]() |
| Formula | C25H28O6 |
| InchiKey | RIWDYFGEQJAMKI-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C(O)C2=C(OCC(C2=O)C2=C(O)C(CC=C(C)C)=C(O)C=C2)C=C1O |
| Inchi | InChI=1S/C25H28O6/c1-13(2)5-7-16-19(26)10-9-15(23(16)28)18-12-31-21-11-20(27)17(8-6-14(3)4)24(29)22(21)25(18)30/h5-6,9-11,18,26-29H,7-8,12H2,1-4H3 |
| IUPAC | 3-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H-1-benzopyran-4-one |
| Molecular Weight | 424.49 |
| Pubchem Id | 480786 |
| Chembl Id | CHEMBL3746555 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | 50134719 |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3746555 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
