Showing entry for (R)-Shinanolone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001784 |
| Compound Name | (R)-Shinanolone |
| Structure | ![]() |
| Formula | C11H12O3 |
| InchiKey | JOCZVRFSKAUXRP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=O)CCC2O)C(O)=C1 |
| Inchi | InChI=1S/C11H12O3/c1-6-4-7-8(12)2-3-9(13)11(7)10(14)5-6/h4-5,8,12,14H,2-3H2,1H3 |
| IUPAC | 4,8-dihydroxy-6-methyl-1,2,3,4-tetrahydronaphthalen-1-one |
| Molecular Weight | 192.21 |
| Pubchem Id | 12315505 |
| Chembl Id | CHEMBL3884255 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3884255 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
