Showing entry for Catechin 3-gallate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001869 |
| Compound Name | Catechin 3-gallate |
| Structure | ![]() |
| Formula | C22H18O10 |
| InchiKey | LSHVYAFMTMFKBA-UHFFFAOYSA-N |
| SMILES | OC1=CC(O)=C2CC(OC(=O)C3=CC(O)=C(O)C(O)=C3)C(OC2=C1)C1=CC(O)=C(O)C=C1 |
| Inchi | InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2 |
| IUPAC | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate |
| Molecular Weight | 442.37 |
| Pubchem Id | 367141 |
| Chembl Id | CHEMBL328085 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50105591 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL328085 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
