Showing entry for Obtustyrene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001883 |
| Compound Name | Obtustyrene |
| Structure | ![]() |
| Formula | C16H16O2 |
| InchiKey | ZAGLUIIUOWEVEN-VMPITWQZSA-N |
| SMILES | COC1=C(C\C=C\C2=CC=CC=C2)C=CC(O)=C1 |
| Inchi | InChI=1S/C16H16O2/c1-18-16-12-15(17)11-10-14(16)9-5-8-13-6-3-2-4-7-13/h2-8,10-12,17H,9H2,1H3/b8-5+ |
| IUPAC | 3-methoxy-4-[(2E)-3-phenylprop-2-en-1-yl]phenol |
| Molecular Weight | 240.3 |
| Pubchem Id | 6450240 |
| Chembl Id | CHEMBL243670 |
| Targets of Information Source | ||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||
| CHEMBL | CHEMBL243670 |
|
||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
