Showing entry for 8-Desoxygartanin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001913 |
| Compound Name | 8-Desoxygartanin |
| Structure | ![]() |
| Formula | C23H24O5 |
| InchiKey | GVQOVMKBYJKZSY-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C(O)C(CC=C(C)C)=C2OC3=C(C=CC=C3O)C(=O)C2=C1O |
| Inchi | InChI=1S/C23H24O5/c1-12(2)8-10-14-19(25)16(11-9-13(3)4)23-18(20(14)26)21(27)15-6-5-7-17(24)22(15)28-23/h5-9,24-26H,10-11H2,1-4H3 |
| IUPAC | 1,3,5-trihydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Molecular Weight | 380.43 |
| Pubchem Id | 392450 |
| Chembl Id | CHEMBL488606 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50311742 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL488606 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
