Showing entry for Demethoxyegonol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001990 |
| Compound Name | Demethoxyegonol |
| Structure | ![]() |
| Formula | C18H16O4 |
| InchiKey | YQEPMZLWYOAQNI-UHFFFAOYSA-N |
| SMILES | OCCCC1=CC2=C(OC(=C2)C2=CC3=C(OCO3)C=C2)C=C1 |
| Inchi | InChI=1S/C18H16O4/c19-7-1-2-12-3-5-15-14(8-12)10-17(22-15)13-4-6-16-18(9-13)21-11-20-16/h3-6,8-10,19H,1-2,7,11H2 |
| IUPAC | 3-[2-(2H-1,3-benzodioxol-5-yl)-1-benzofuran-5-yl]propan-1-ol |
| Molecular Weight | 296.32 |
| Pubchem Id | 10402297 |
| Chembl Id | CHEMBL470982 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL470982 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
