Showing entry for Mammea A/AB
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0001998 |
| Compound Name | Mammea A/AB |
| Structure | ![]() |
| Formula | C25H26O5 |
| InchiKey | YALRCXHVQYBSJC-UHFFFAOYSA-N |
| SMILES | CCC(C)C(=O)C1=C(O)C(CC=C(C)C)=C2OC(=O)C=C(C3=CC=CC=C3)C2=C1O |
| Inchi | InChI=1S/C25H26O5/c1-5-15(4)22(27)21-23(28)17(12-11-14(2)3)25-20(24(21)29)18(13-19(26)30-25)16-9-7-6-8-10-16/h6-11,13,15,28-29H,5,12H2,1-4H3 |
| IUPAC | 5,7-dihydroxy-8-(3-methylbut-2-en-1-yl)-6-(2-methylbutanoyl)-4-phenyl-2H-chromen-2-one |
| Molecular Weight | 406.47 |
| Pubchem Id | 6483317 |
| Chembl Id | CHEMBL194782 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL194782 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
