Showing entry for Mammeigin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002005 |
| Compound Name | Mammeigin |
| Structure | ![]() |
| Formula | C25H24O5 |
| InchiKey | VSDJRZADBKXDHP-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=C2OC(C)(C)C=CC2=C2OC(=O)C=C(C3=CC=CC=C3)C2=C1O |
| Inchi | InChI=1S/C25H24O5/c1-14(2)12-18(26)21-22(28)20-17(15-8-6-5-7-9-15)13-19(27)29-23(20)16-10-11-25(3,4)30-24(16)21/h5-11,13-14,28H,12H2,1-4H3 |
| IUPAC | 5-hydroxy-8,8-dimethyl-6-(3-methylbutanoyl)-4-phenyl-2H,8H-pyrano[2,3-f]chromen-2-one |
| Molecular Weight | 404.46 |
| Pubchem Id | 5319255 |
| Chembl Id | CHEMBL195013 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL195013 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
