Showing entry for (2R,3S)-Piscidic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002039 |
| Compound Name | (2R,3S)-Piscidic acid |
| Structure | ![]() |
| Formula | C11H12O7 |
| InchiKey | TUODPMGCCJSJRH-UHFFFAOYSA-N |
| SMILES | OC(C(O)=O)C(O)(CC1=CC=C(O)C=C1)C(O)=O |
| Inchi | InChI=1S/C11H12O7/c12-7-3-1-6(2-4-7)5-11(18,10(16)17)8(13)9(14)15/h1-4,8,12-13,18H,5H2,(H,14,15)(H,16,17) |
| IUPAC | 2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid |
| Molecular Weight | 256.21 |
| Pubchem Id | 120693 |
| Chembl Id | CHEMBL1474079 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1474079 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
