Showing entry for 3,8-Dihydroxy-1-methylanthraquinone-2-carboxylic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002062 |
| Compound Name | 3,8-Dihydroxy-1-methylanthraquinone-2-carboxylic acid |
| Structure | ![]() |
| Formula | C16H10O6 |
| InchiKey | MHABMANUFPZXEB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=O)C3=C(C=CC=C3O)C(=O)C2=CC(O)=C1C(O)=O |
| Inchi | InChI=1S/C16H10O6/c1-6-11-8(5-10(18)12(6)16(21)22)14(19)7-3-2-4-9(17)13(7)15(11)20/h2-5,17-18H,1H3,(H,21,22) |
| IUPAC | 3,8-dihydroxy-1-methyl-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid |
| Molecular Weight | 298.25 |
| Pubchem Id | 14379528 |
| Chembl Id | CHEMBL235387 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL235387 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
