Showing entry for Artocarpesin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002080 |
| Compound Name | Artocarpesin |
| Structure | ![]() |
| Formula | C20H18O6 |
| InchiKey | YWUVFGZTDLJVCR-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=C(O)C2=C(OC(=CC2=O)C2=C(O)C=C(O)C=C2)C=C1O |
| Inchi | InChI=1S/C20H18O6/c1-10(2)3-5-13-15(23)8-18-19(20(13)25)16(24)9-17(26-18)12-6-4-11(21)7-14(12)22/h3-4,6-9,21-23,25H,5H2,1-2H3 |
| IUPAC | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Molecular Weight | 354.35 |
| Pubchem Id | 399491 |
| Chembl Id | CHEMBL1915458 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50358100 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1915458 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
