Showing entry for Kuwanon E
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002090 |
| Compound Name | Kuwanon E |
| Structure | ![]() |
| Formula | C25H28O6 |
| InchiKey | GJFHZVPRFLHEBR-VIZOYTHASA-N |
| SMILES | CC(C)=CCC\C(C)=C\CC1=CC(C2CC(=O)C3=C(O)C=C(O)C=C3O2)=C(O)C=C1O |
| Inchi | InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-8-16-9-18(20(28)12-19(16)27)23-13-22(30)25-21(29)10-17(26)11-24(25)31-23/h5,7,9-12,23,26-29H,4,6,8,13H2,1-3H3/b15-7+ |
| IUPAC | 2-{5-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-2,4-dihydroxyphenyl}-5,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-4-one |
| Molecular Weight | 424.49 |
| Pubchem Id | 10342292 |
| Chembl Id | CHEMBL1096939 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1096939 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
