Showing entry for Kuwanon F
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002091 |
| Compound Name | Kuwanon F |
| Structure | ![]() |
| Formula | C25H26O6 |
| InchiKey | FZAZNGMSARSUNC-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC1(C)OC2=C(C=C1)C=C(C1CC(=O)C3=C(O)C=C(O)C=C3O1)C(O)=C2 |
| Inchi | InChI=1S/C25H26O6/c1-14(2)5-4-7-25(3)8-6-15-9-17(18(27)12-21(15)31-25)22-13-20(29)24-19(28)10-16(26)11-23(24)30-22/h5-6,8-12,22,26-28H,4,7,13H2,1-3H3 |
| IUPAC | 5,7-dihydroxy-2-[7-hydroxy-2-methyl-2-(4-methylpent-3-en-1-yl)-2H-chromen-6-yl]-3,4-dihydro-2H-1-benzopyran-4-one |
| Molecular Weight | 422.47 |
| Pubchem Id | 156149 |
| Chembl Id | CHEMBL4160223 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4160223 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
