Showing entry for Auxin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002611 |
| Compound Name | Auxin |
| Structure | ![]() |
| Formula | C10H8NO2 |
| InchiKey | SEOVTRFCIGRIMH-UHFFFAOYSA-M |
| SMILES | [O-]C(=O)CC1=CNC2=CC=CC=C12 |
| Inchi | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 |
| IUPAC | 2-(1H-indol-3-yl)acetate |
| Molecular Weight | 174.18 |
| Pubchem Id | 801 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 92694 |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
