Showing entry for Cnidilide
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0002774 |
| Compound Name | Cnidilide |
| Structure | ![]() |
| Formula | C12H18O2 |
| InchiKey | UXDIXFDKSPCUIX-AXFHLTTASA-N |
| SMILES | CCCC[C@@H]1OC(=O)[C@@H]2C=CCC[C@H]12 |
| Inchi | InChI=1S/C12H18O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7,9-11H,2-4,6,8H2,1H3/t9-,10+,11-/m0/s1 |
| IUPAC | (3S,3aS,7aR)-3-butyl-1,3,3a,4,5,7a-hexahydro-2-benzofuran-1-one |
| Molecular Weight | 194.27 |
| Pubchem Id | 160710 |
| Chembl Id | CHEMBL2252753 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2252753 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
