Showing entry for 5-Methylcytosine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003013 |
| Compound Name | 5-Methylcytosine |
| Structure | ![]() |
| Formula | C5H7N3O |
| InchiKey | LRSASMSXMSNRBT-UHFFFAOYSA-N |
| SMILES | CC1=C(N)NC(=O)N=C1 |
| Inchi | InChI=1S/C5H7N3O/c1-3-2-7-5(9)8-4(3)6/h2H,1H3,(H3,6,7,8,9) |
| IUPAC | 6-amino-5-methyl-1,2-dihydropyrimidin-2-one |
| Molecular Weight | 125.13 |
| Pubchem Id | 65040 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | 17E |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
