Showing entry for Pyrrol-2-methylketone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003067 |
| Compound Name | Pyrrol-2-methylketone |
| Structure | ![]() |
| Formula | C6H7NO |
| InchiKey | IGJQUJNPMOYEJY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CN1 |
| Inchi | InChI=1S/C6H7NO/c1-5(8)6-3-2-4-7-6/h2-4,7H,1H3 |
| IUPAC | 1-(1H-pyrrol-2-yl)ethan-1-one |
| Molecular Weight | 109.13 |
| Pubchem Id | 14079 |
| Chembl Id | CHEMBL1414126 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1414126 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
