Showing entry for Citronetin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003229 |
| Compound Name | Citronetin |
| Structure | ![]() |
| Formula | C15H12O5 |
| InchiKey | LSLXUDALHVEMQB-UHFFFAOYSA-N |
| SMILES | OC1=CC(O)=C2C(=O)CC(OC2=C1)C1=CC=CC=C1O |
| Inchi | InChI=1S/C15H12O5/c16-8-5-11(18)15-12(19)7-13(20-14(15)6-8)9-3-1-2-4-10(9)17/h1-6,13,16-18H,7H2 |
| IUPAC | 5,7-dihydroxy-2-(2-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one |
| Molecular Weight | 272.25 |
| Pubchem Id | 179999 |
| Chembl Id | CHEMBL4278949 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4278949 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
