Showing entry for 2-Hydroxy-4-methoxybenzaldehyde
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003478 |
| Compound Name | 2-Hydroxy-4-methoxybenzaldehyde |
| Structure | ![]() |
| Formula | C8H8O3 |
| InchiKey | WZUODJNEIXSNEU-UHFFFAOYSA-N |
| SMILES | COC1=CC(O)=C(C=O)C=C1 |
| Inchi | InChI=1S/C8H8O3/c1-11-7-3-2-6(5-9)8(10)4-7/h2-5,10H,1H3 |
| IUPAC | 2-hydroxy-4-methoxybenzaldehyde |
| Molecular Weight | 152.15 |
| Pubchem Id | 69600 |
| Chembl Id | CHEMBL350966 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50139368 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL350966 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
