Showing entry for Momordin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003600 |
| Compound Name | Momordin |
| Structure | ![]() |
| Formula | C7H14NO5P |
| InchiKey | KRTSDMXIXPKRQR-AATRIKPKSA-N |
| SMILES | CNC(=O)\C=C(/C)OP(=O)(OC)OC |
| Inchi | InChI=1S/C7H14NO5P/c1-6(5-7(9)8-2)13-14(10,11-3)12-4/h5H,1-4H3,(H,8,9)/b6-5+ |
| IUPAC | (2E)-3-[(dimethoxyphosphoryl)oxy]-N-methylbut-2-enamide |
| Molecular Weight | 223.16 |
| Pubchem Id | 5371562 |
| Chembl Id | CHEMBL2272785 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2272785 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
