Showing entry for Diethylstilbesterol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0003989 |
| Compound Name | Diethylstilbesterol |
| Structure | ![]() |
| Formula | C18H20O2 |
| InchiKey | RGLYKWWBQGJZGM-UHFFFAOYSA-N |
| SMILES | CCC(=C(CC)C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
| Inchi | InChI=1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3 |
| IUPAC | 4-[4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
| Molecular Weight | 268.35 |
| Pubchem Id | 3054 |
| Chembl Id | CHEMBL2135534 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2135534 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
