Showing entry for 2H-1,4-Benzoxazin-3(4H)-one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004019 |
| Compound Name | 2H-1,4-Benzoxazin-3(4H)-one |
| Structure | ![]() |
| Formula | C8H7NO2 |
| InchiKey | QRCGFTXRXYMJOS-UHFFFAOYSA-N |
| SMILES | O=C1COC2=C(N1)C=CC=C2 |
| Inchi | InChI=1S/C8H7NO2/c10-8-5-11-7-4-2-1-3-6(7)9-8/h1-4H,5H2,(H,9,10) |
| IUPAC | 3,4-dihydro-2H-1,4-benzoxazin-3-one |
| Molecular Weight | 149.15 |
| Pubchem Id | 72757 |
| Chembl Id | CHEMBL460153 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50438258 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL460153 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
