Showing entry for Chelidonic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004027 |
| Compound Name | Chelidonic acid |
| Structure | ![]() |
| Formula | C7H4O6 |
| InchiKey | PBAYDYUZOSNJGU-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC(=O)C=C(O1)C(O)=O |
| Inchi | InChI=1S/C7H4O6/c8-3-1-4(6(9)10)13-5(2-3)7(11)12/h1-2H,(H,9,10)(H,11,12) |
| IUPAC | 4-oxo-4H-pyran-2,6-dicarboxylic acid |
| Molecular Weight | 184.1 |
| Pubchem Id | 7431 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | HLD |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
