Showing entry for Fluorene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004031 |
| Compound Name | Fluorene |
| Structure | ![]() |
| Formula | C13H10 |
| InchiKey | NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C2=CC=CC=C12 |
| Inchi | InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
| IUPAC | 9H-fluorene |
| Molecular Weight | 166.22 |
| Pubchem Id | 6853 |
| Chembl Id | CHEMBL16236 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | 9FL |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL16236 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
