Showing entry for 2,4-Pentanedione
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004280 |
| Compound Name | 2,4-Pentanedione |
| Structure | ![]() |
| Formula | C5H8O2 |
| InchiKey | YRKCREAYFQTBPV-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)=O |
| Inchi | InChI=1S/C5H8O2/c1-4(6)3-5(2)7/h3H2,1-2H3 |
| IUPAC | pentane-2,4-dione |
| Molecular Weight | 100.12 |
| Pubchem Id | 31261 |
| Chembl Id | CHEMBL191625 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | P2D |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 22766 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL191625 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
