Showing entry for (S,E)-Zearalenone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004356 |
| Compound Name | (S,E)-Zearalenone |
| Structure | ![]() |
| Formula | C18H22O5 |
| InchiKey | MBMQEIFVQACCCH-XVNBXDOJSA-N |
| SMILES | [H]\C1=C([H])/C2=CC(O)=CC(O)=C2C(=O)OC(C)CCCC(=O)CCC1 |
| Inchi | InChI=1S/C18H22O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,20-21H,2,4-6,8-9H2,1H3/b7-3+ |
| IUPAC | 14,16-dihydroxy-3-methyl-3,4,5,6,7,8,9,10-octahydro-1H-2-benzoxacyclotetradecine-1,7-dione |
| Molecular Weight | 318.36 |
| Pubchem Id | 5375083 |
| Chembl Id | CHEMBL1397216 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1397216 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
