Showing entry for Norfuraneol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004406 |
| Compound Name | Norfuraneol |
| Structure | ![]() |
| Formula | C5H6O3 |
| InchiKey | DLVYTANECMRFGX-UHFFFAOYSA-N |
| SMILES | CC1=C(O)C(=O)CO1 |
| Inchi | InChI=1S/C5H6O3/c1-3-5(7)4(6)2-8-3/h7H,2H2,1H3 |
| IUPAC | 4-hydroxy-5-methyl-2,3-dihydrofuran-3-one |
| Molecular Weight | 114.1 |
| Pubchem Id | 4564493 |
| Chembl Id | CHEMBL3182150 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | 4XX |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3182150 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
