Showing entry for Glyurallin B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004466 |
| Compound Name | Glyurallin B |
| Structure | ![]() |
| Formula | C25H26O6 |
| InchiKey | DPLWUTYEBRKBLI-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1=CC(=CC(O)=C1O)C1=COC2=C(CC=C(C)C)C(O)=CC(O)=C2C1=O |
| Inchi | InChI=1S/C25H26O6/c1-13(2)5-7-15-9-16(10-21(28)23(15)29)18-12-31-25-17(8-6-14(3)4)19(26)11-20(27)22(25)24(18)30/h5-6,9-12,26-29H,7-8H2,1-4H3 |
| IUPAC | 3-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-8-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Molecular Weight | 422.47 |
| Pubchem Id | 15818599 |
| Chembl Id | CHEMBL4068000 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4068000 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
