Showing entry for 2-Geranyl-2',3,4,4'-tetrahydroxydihydrochalcone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004536 |
| Compound Name | 2-Geranyl-2',3,4,4'-tetrahydroxydihydrochalcone |
| Structure | ![]() |
| Formula | C25H30O5 |
| InchiKey | FVNFXIPJDHVJGE-REZTVBANSA-N |
| SMILES | CC(C)=CCC\C(C)=C\CC1=C(CCC(=O)C2=C(O)C=C(O)C=C2)C=CC(O)=C1O |
| Inchi | InChI=1S/C25H30O5/c1-16(2)5-4-6-17(3)7-11-20-18(9-14-23(28)25(20)30)8-13-22(27)21-12-10-19(26)15-24(21)29/h5,7,9-10,12,14-15,26,28-30H,4,6,8,11,13H2,1-3H3/b17-7+ |
| IUPAC | 1-(2,4-dihydroxyphenyl)-3-{2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,4-dihydroxyphenyl}propan-1-one |
| Molecular Weight | 410.5 |
| Pubchem Id | 6449829 |
| Chembl Id | CHEMBL523392 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL523392 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
