Showing entry for 3,4-Methylenedioxybenzaldehyde
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004744 |
| Compound Name | 3,4-Methylenedioxybenzaldehyde |
| Structure | ![]() |
| Formula | C8H6O3 |
| InchiKey | SATCULPHIDQDRE-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C1=CC2=C(OCO2)C=C1 |
| Inchi | InChI=1S/C8H6O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4H,5H2 |
| IUPAC | 2H-1,3-benzodioxole-5-carbaldehyde |
| Molecular Weight | 150.13 |
| Pubchem Id | 8438 |
| Chembl Id | CHEMBL271663 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | 5XC |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL271663 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
