Showing entry for Benzofuran
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0004998 |
| Compound Name | Benzofuran |
| Structure | ![]() |
| Formula | C8H6O |
| InchiKey | IANQTJSKSUMEQM-UHFFFAOYSA-N |
| SMILES | O1C=CC2=C1C=CC=C2 |
| Inchi | InChI=1S/C8H6O/c1-2-4-8-7(3-1)5-6-9-8/h1-6H |
| IUPAC | 1-benzofuran |
| Molecular Weight | 118.13 |
| Pubchem Id | 9223 |
| Chembl Id | CHEMBL363614 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | DB04179 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | BZF |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL363614 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
