Showing entry for 5,7-Dihydroxy-4H-1-benzopyran-4-one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005016 |
| Compound Name | 5,7-Dihydroxy-4H-1-benzopyran-4-one |
| Structure | ![]() |
| Formula | C9H6O4 |
| InchiKey | NYCXYKOXLNBYID-UHFFFAOYSA-N |
| SMILES | OC1=CC(O)=C2C(=O)C=COC2=C1 |
| Inchi | InChI=1S/C9H6O4/c10-5-3-7(12)9-6(11)1-2-13-8(9)4-5/h1-4,10,12H |
| IUPAC | 5,7-dihydroxy-4H-chromen-4-one |
| Molecular Weight | 178.14 |
| Pubchem Id | 5281343 |
| Chembl Id | CHEMBL3604316 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | B7S |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50115096 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3604316 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
