Showing entry for Anofinic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005306 |
| Compound Name | Anofinic acid |
| Structure | ![]() |
| Formula | C12H12O3 |
| InchiKey | AXICIBPYBONRSP-UHFFFAOYSA-N |
| SMILES | CC1(C)OC2=C(C=C1)C=C(C=C2)C(O)=O |
| Inchi | InChI=1S/C12H12O3/c1-12(2)6-5-8-7-9(11(13)14)3-4-10(8)15-12/h3-7H,1-2H3,(H,13,14) |
| IUPAC | 2,2-dimethyl-2H-chromene-6-carboxylic acid |
| Molecular Weight | 204.22 |
| Pubchem Id | 5319235 |
| Chembl Id | CHEMBL469159 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL469159 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
