Showing entry for Moracin I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005314 |
| Compound Name | Moracin I |
| Structure | ![]() |
| Formula | C20H20O4 |
| InchiKey | MRJQFSZVXAESPR-UHFFFAOYSA-N |
| SMILES | COC1=CC(O)=CC(C2=CC3=C(O2)C=C(O)C=C3)=C1CC=C(C)C |
| Inchi | InChI=1S/C20H20O4/c1-12(2)4-7-16-17(9-15(22)11-19(16)23-3)20-8-13-5-6-14(21)10-18(13)24-20/h4-6,8-11,21-22H,7H2,1-3H3 |
| IUPAC | 2-[5-hydroxy-3-methoxy-2-(3-methylbut-2-en-1-yl)phenyl]-1-benzofuran-6-ol |
| Molecular Weight | 324.37 |
| Pubchem Id | 155976 |
| Chembl Id | CHEMBL463435 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL463435 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
