Showing entry for Oxonantenine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005361 |
| Compound Name | Oxonantenine |
| Structure | ![]() |
| Formula | C19H13NO5 |
| InchiKey | NFDVJYPMLVMXRR-UHFFFAOYSA-N |
| SMILES | COC1=C(OC)C2=C3C(C=CN=C3C(=O)C3=CC4=C(OCO4)C=C23)=C1 |
| Inchi | InChI=1S/C19H13NO5/c1-22-14-5-9-3-4-20-17-15(9)16(19(14)23-2)10-6-12-13(25-8-24-12)7-11(10)18(17)21/h3-7H,8H2,1-2H3 |
| IUPAC | 18,19-dimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,1?.0?,?.01?,2?]icosa-1(20),2,4(8),9,12,14,16,18-octaen-11-one |
| Molecular Weight | 335.31 |
| Pubchem Id | 3084224 |
| Chembl Id | CHEMBL1270949 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50328696 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1270949 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
