Showing entry for Phlorisovalerophenone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005720 |
| Compound Name | Phlorisovalerophenone |
| Structure | ![]() |
| Formula | C11H14O4 |
| InchiKey | VSDWHZGJGWMIRN-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=C(O)C=C(O)C=C1O |
| Inchi | InChI=1S/C11H14O4/c1-6(2)3-8(13)11-9(14)4-7(12)5-10(11)15/h4-6,12,14-15H,3H2,1-2H3 |
| IUPAC | 3-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one |
| Molecular Weight | 210.23 |
| Pubchem Id | 441269 |
| Chembl Id | CHEMBL19948 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50196895 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL19948 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
