Showing entry for (-)-2-Hydroxy-2-isopropylbutanedioic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005743 |
| Compound Name | (-)-2-Hydroxy-2-isopropylbutanedioic acid |
| Structure | ![]() |
| Formula | C7H12O5 |
| InchiKey | BITYXLXUCSKTJS-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@](O)(CC(O)=O)C(O)=O |
| Inchi | InChI=1S/C7H12O5/c1-4(2)7(12,6(10)11)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11)/t7-/m0/s1 |
| IUPAC | (2S)-2-hydroxy-2-(propan-2-yl)butanedioic acid |
| Molecular Weight | 176.17 |
| Pubchem Id | 5280523 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | VPM |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
