Showing entry for Aloe emodin w-acetate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005837 |
| Compound Name | Aloe emodin w-acetate |
| Structure | ![]() |
| Formula | C17H12O6 |
| InchiKey | FUECAILUKAJTBR-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=CC2=C(C(O)=C1)C(=O)C1=C(C=CC=C1O)C2=O |
| Inchi | InChI=1S/C17H12O6/c1-8(18)23-7-9-5-11-15(13(20)6-9)17(22)14-10(16(11)21)3-2-4-12(14)19/h2-6,19-20H,7H2,1H3 |
| IUPAC | (4,5-dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)methyl acetate |
| Molecular Weight | 312.27 |
| Pubchem Id | 10425624 |
| Chembl Id | CHEMBL3104736 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 150754 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3104736 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
