Showing entry for Methylxanthoxylin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0005979 |
| Compound Name | Methylxanthoxylin |
| Structure | ![]() |
| Formula | C11H14O4 |
| InchiKey | AAOFJKLTRKOQTQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(OC)=C(C(C)=O)C(O)=C1C |
| Inchi | InChI=1S/C11H14O4/c1-6-8(14-3)5-9(15-4)10(7(2)12)11(6)13/h5,13H,1-4H3 |
| IUPAC | 1-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)ethan-1-one |
| Molecular Weight | 210.23 |
| Pubchem Id | 326186 |
| Chembl Id | CHEMBL1484869 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1484869 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
